C12H14F2N2O4 — CID 107121702
N-(3-ethoxypropyl)-2,5-difluoro-3-nitrobenzamide (PubChem CID 107121702) has the molecular formula C12H14F2N2O4 and a molecular weight of 288.25 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2,5-difluoro-3-nitrobenzamide.
| Compound Name | N-(3-ethoxypropyl)-2,5-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 107121702 |
| Molecular Formula | C12H14F2N2O4 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-(3-ethoxypropyl)-2,5-difluoro-3-nitrobenzamide |
| SMILES | CCOCCCNC(=O)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C12H14F2N2O4/c1-2-20-5-3-4-15-12(17)9-6-8(13)7-10(11(9)14)16(18)19/h6-7H,2-5H2,1H3,(H,15,17) |
| InChIKey | UCWAXTCTFPMTBF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|