C7H4F2N2O4 — CID 107122467
2,5-difluoro-N-hydroxy-3-nitrobenzamide (PubChem CID 107122467) has the molecular formula C7H4F2N2O4 and a molecular weight of 218.11 g/mol. Its IUPAC name is 2,5-difluoro-N-hydroxy-3-nitrobenzamide.
| Compound Name | 2,5-difluoro-N-hydroxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 107122467 |
| Molecular Formula | C7H4F2N2O4 |
| Molecular Weight | 218.11 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 2,5-difluoro-N-hydroxy-3-nitrobenzamide |
| SMILES | O=C(NO)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C7H4F2N2O4/c8-3-1-4(7(12)10-13)6(9)5(2-3)11(14)15/h1-2,13H,(H,10,12) |
| InChIKey | TWMVQFAYSZBBPA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.11 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|