C12H13BrF2N2O3 — CID 107123522
N-(3-bromo-2,2-dimethylpropyl)-2,5-difluoro-3-nitrobenzamide (PubChem CID 107123522) has the molecular formula C12H13BrF2N2O3 and a molecular weight of 351.15 g/mol. Its IUPAC name is N-(3-bromo-2,2-dimethylpropyl)-2,5-difluoro-3-nitrobenzamide.
| Compound Name | N-(3-bromo-2,2-dimethylpropyl)-2,5-difluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 107123522 |
| Molecular Formula | C12H13BrF2N2O3 |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | N-(3-bromo-2,2-dimethylpropyl)-2,5-difluoro-3-nitrobenzamide |
| SMILES | CC(C)(CBr)CNC(=O)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C12H13BrF2N2O3/c1-12(2,5-13)6-16-11(18)8-3-7(14)4-9(10(8)15)17(19)20/h3-4H,5-6H2,1-2H3,(H,16,18) |
| InChIKey | XPSZMJYQERVFGQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|