C13H18FN3O3 — CID 106548251
2-amino-N-(2,2-dimethylbutyl)-5-fluoro-3-nitrobenzamide (PubChem CID 106548251) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is 2-amino-N-(2,2-dimethylbutyl)-5-fluoro-3-nitrobenzamide.
| Compound Name | 2-amino-N-(2,2-dimethylbutyl)-5-fluoro-3-nitrobenzamide |
|---|---|
| PubChem CID | 106548251 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-amino-N-(2,2-dimethylbutyl)-5-fluoro-3-nitrobenzamide |
| SMILES | CCC(C)(C)CNC(=O)c1cc(F)cc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C13H18FN3O3/c1-4-13(2,3)7-16-12(18)9-5-8(14)6-10(11(9)15)17(19)20/h5-6H,4,7,15H2,1-3H3,(H,16,18) |
| InChIKey | FOHRBGXMFVKYOJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|