C9H11FN4O3 — CID 107123296
2-amino-5-fluoro-N',N'-dimethyl-3-nitrobenzohydrazide (PubChem CID 107123296) has the molecular formula C9H11FN4O3 and a molecular weight of 242.21 g/mol. Its IUPAC name is 2-amino-5-fluoro-N',N'-dimethyl-3-nitrobenzohydrazide.
| Compound Name | 2-amino-5-fluoro-N',N'-dimethyl-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 107123296 |
| Molecular Formula | C9H11FN4O3 |
| Molecular Weight | 242.21 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-amino-5-fluoro-N',N'-dimethyl-3-nitrobenzohydrazide |
| SMILES | CN(C)NC(=O)c1cc(F)cc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C9H11FN4O3/c1-13(2)12-9(15)6-3-5(10)4-7(8(6)11)14(16)17/h3-4H,11H2,1-2H3,(H,12,15) |
| InChIKey | GVBSVUQXTJDBGE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.21 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|