C16H16FN3O6 — CID 55825075
2-amino-5-fluoro-3-nitro-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 55825075) has the molecular formula C16H16FN3O6 and a molecular weight of 365.32 g/mol. Its IUPAC name is 2-amino-5-fluoro-3-nitro-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 2-amino-5-fluoro-3-nitro-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 55825075 |
| Molecular Formula | C16H16FN3O6 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-amino-5-fluoro-3-nitro-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2cc(F)cc([N+](=O)[O-])c2N)cc(OC)c1OC |
| InChI | InChI=1S/C16H16FN3O6/c1-24-12-6-9(7-13(25-2)15(12)26-3)19-16(21)10-4-8(17)5-11(14(10)18)20(22)23/h4-7H,18H2,1-3H3,(H,19,21) |
| InChIKey | ZMLMGUVZAJYSBA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|