C21H19FN4O6S — CID 55974376
2-amino-5-fluoro-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]-3-nitrobenzamide (PubChem CID 55974376) has the molecular formula C21H19FN4O6S and a molecular weight of 474.47 g/mol. Its IUPAC name is 2-amino-5-fluoro-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]-3-nitrobenzamide.
| Compound Name | 2-amino-5-fluoro-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55974376 |
| Molecular Formula | C21H19FN4O6S |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 2-amino-5-fluoro-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-methylphenyl]-3-nitrobenzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(NC(=O)c2cc(F)cc([N+](=O)[O-])c2N)ccc1C |
| InChI | InChI=1S/C21H19FN4O6S/c1-12-7-8-14(24-21(27)15-9-13(22)10-17(20(15)23)26(28)29)11-19(12)33(30,31)25-16-5-3-4-6-18(16)32-2/h3-11,25H,23H2,1-2H3,(H,24,27) |
| InChIKey | XDDUTUNAYSTMIX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|