C24H24N4O7S — CID 4560302
N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-2-nitrobenzamide (PubChem CID 4560302) has the molecular formula C24H24N4O7S and a molecular weight of 512.54 g/mol. Its IUPAC name is N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-2-nitrobenzamide.
| Compound Name | N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 4560302 |
| Molecular Formula | C24H24N4O7S |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-2-nitrobenzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(NC(=O)c2ccccc2[N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C24H24N4O7S/c1-34-22-9-5-3-7-19(22)26-36(32,33)23-16-17(10-11-21(23)27-12-14-35-15-13-27)25-24(29)18-6-2-4-8-20(18)28(30)31/h2-11,16,26H,12-15H2,1H3,(H,25,29) |
| InChIKey | CDRWVEUIOQPRRW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|