C29H32N4O6S — CID 4834845
1-benzyl-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 4834845) has the molecular formula C29H32N4O6S and a molecular weight of 564.66 g/mol. Its IUPAC name is 1-benzyl-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-benzyl-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 4834845 |
| Molecular Formula | C29H32N4O6S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | 1-benzyl-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(NC(=O)C2CC(=O)N(Cc3ccccc3)C2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C29H32N4O6S/c1-38-26-10-6-5-9-24(26)31-40(36,37)27-18-23(11-12-25(27)32-13-15-39-16-14-32)30-29(35)22-17-28(34)33(20-22)19-21-7-3-2-4-8-21/h2-12,18,22,31H,13-17,19-20H2,1H3,(H,30,35) |
| InChIKey | ONVQSIQKXTYFEQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|