C26H30N4O7S2 — CID 4849688
3-(dimethylsulfamoyl)-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]benzamide (PubChem CID 4849688) has the molecular formula C26H30N4O7S2 and a molecular weight of 574.68 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]benzamide |
|---|---|
| PubChem CID | 4849688 |
| Molecular Formula | C26H30N4O7S2 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.16 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(NC(=O)c2cccc(S(=O)(=O)N(C)C)c2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C26H30N4O7S2/c1-29(2)39(34,35)21-8-6-7-19(17-21)26(31)27-20-11-12-23(30-13-15-37-16-14-30)25(18-20)38(32,33)28-22-9-4-5-10-24(22)36-3/h4-12,17-18,28H,13-16H2,1-3H3,(H,27,31) |
| InChIKey | REVTWROJVJWDRF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|