C25H25N3O6S — CID 4845849
N-[3-[(2-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 4845849) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is N-[3-[(2-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-[(2-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 4845849 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | N-[3-[(2-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(NC(=O)c2ccc3c(c2)OCO3)ccc1N1CCCC1 |
| InChI | InChI=1S/C25H25N3O6S/c1-32-21-7-3-2-6-19(21)27-35(30,31)24-15-18(9-10-20(24)28-12-4-5-13-28)26-25(29)17-8-11-22-23(14-17)34-16-33-22/h2-3,6-11,14-15,27H,4-5,12-13,16H2,1H3,(H,26,29) |
| InChIKey | JQNOVSOPCVDGGM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|