C22H23N5O5S — CID 3438508
N-[3-[(2-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 3438508) has the molecular formula C22H23N5O5S and a molecular weight of 469.52 g/mol. Its IUPAC name is N-[3-[(2-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[3-[(2-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 3438508 |
| Molecular Formula | C22H23N5O5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-[3-[(2-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(NC(=O)c2ccc(=O)[nH]n2)ccc1N1CCCC1 |
| InChI | InChI=1S/C22H23N5O5S/c1-32-19-7-3-2-6-16(19)26-33(30,31)20-14-15(8-10-18(20)27-12-4-5-13-27)23-22(29)17-9-11-21(28)25-24-17/h2-3,6-11,14,26H,4-5,12-13H2,1H3,(H,23,29)(H,25,28) |
| InChIKey | UTQVKCSCSTVUAT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|