C30H36N4O6S2 — CID 5040459
N-[3-[(2-methoxyphenyl)sulfamoyl]-4-piperidin-1-ylphenyl]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 5040459) has the molecular formula C30H36N4O6S2 and a molecular weight of 612.77 g/mol. Its IUPAC name is N-[3-[(2-methoxyphenyl)sulfamoyl]-4-piperidin-1-ylphenyl]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-[(2-methoxyphenyl)sulfamoyl]-4-piperidin-1-ylphenyl]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 5040459 |
| Molecular Formula | C30H36N4O6S2 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | N-[3-[(2-methoxyphenyl)sulfamoyl]-4-piperidin-1-ylphenyl]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(NC(=O)c2cccc(S(=O)(=O)N3CCCCC3)c2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C30H36N4O6S2/c1-40-28-14-5-4-13-26(28)32-41(36,37)29-22-24(15-16-27(29)33-17-6-2-7-18-33)31-30(35)23-11-10-12-25(21-23)42(38,39)34-19-8-3-9-20-34/h4-5,10-16,21-22,32H,2-3,6-9,17-20H2,1H3,(H,31,35) |
| InChIKey | OSDSJXMWNRLFAT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|