C27H31N3O7S — CID 3359599
2,4,5-trimethoxy-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]benzamide (PubChem CID 3359599) has the molecular formula C27H31N3O7S and a molecular weight of 541.63 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]benzamide.
| Compound Name | 2,4,5-trimethoxy-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]benzamide |
|---|---|
| PubChem CID | 3359599 |
| Molecular Formula | C27H31N3O7S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 2,4,5-trimethoxy-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(NC(=O)c2cc(OC)c(OC)cc2OC)ccc1N1CCCC1 |
| InChI | InChI=1S/C27H31N3O7S/c1-34-22-10-6-5-9-20(22)29-38(32,33)26-15-18(11-12-21(26)30-13-7-8-14-30)28-27(31)19-16-24(36-3)25(37-4)17-23(19)35-2/h5-6,9-12,15-17,29H,7-8,13-14H2,1-4H3,(H,28,31) |
| InChIKey | KEQOVAFKLFZJKF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|