C22H26ClN3O3S — CID 25349683
cis-(1R,2S)-N-[3-[(2-chlorophenyl)sulfamoyl]-4-piperidin-1-ylphenyl]-2-methylcyclopropane-1-carboxamide (PubChem CID 25349683) has the molecular formula C22H26ClN3O3S and a molecular weight of 447.99 g/mol. Its IUPAC name is cis-(1R,2S)-N-[3-[(2-chlorophenyl)sulfamoyl]-4-piperidin-1-ylphenyl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[3-[(2-chlorophenyl)sulfamoyl]-4-piperidin-1-ylphenyl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 25349683 |
| Molecular Formula | C22H26ClN3O3S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | cis-(1R,2S)-N-[3-[(2-chlorophenyl)sulfamoyl]-4-piperidin-1-ylphenyl]-2-methylcyclopropane-1-carboxamide |
| SMILES | C[C@H]1C[C@H]1C(=O)Nc1ccc(N2CCCCC2)c(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C22H26ClN3O3S/c1-15-13-17(15)22(27)24-16-9-10-20(26-11-5-2-6-12-26)21(14-16)30(28,29)25-19-8-4-3-7-18(19)23/h3-4,7-10,14-15,17,25H,2,5-6,11-13H2,1H3,(H,24,27)/t15-,17+/m0/s1 |
| InChIKey | XEILDONCPIMFTI-DOTOQJQBSA-N |
| XLogP | 4.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|