C32H26Cl2N4O3S — CID 3270456
2-(4-chlorophenyl)-N-[3-[(2-chlorophenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]quinoline-4-carboxamide (PubChem CID 3270456) has the molecular formula C32H26Cl2N4O3S and a molecular weight of 617.56 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[3-[(2-chlorophenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[3-[(2-chlorophenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3270456 |
| Molecular Formula | C32H26Cl2N4O3S |
| Molecular Weight | 617.56 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[3-[(2-chlorophenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]quinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(S(=O)(=O)Nc2ccccc2Cl)c1)c1cc(-c2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C32H26Cl2N4O3S/c33-22-13-11-21(12-14-22)29-20-25(24-7-1-3-9-27(24)36-29)32(39)35-23-15-16-30(38-17-5-6-18-38)31(19-23)42(40,41)37-28-10-4-2-8-26(28)34/h1-4,7-16,19-20,37H,5-6,17-18H2,(H,35,39) |
| InChIKey | OXYFIRZNUSFDIT-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.56 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|