C23H18ClN3O3S — CID 39204456
2-(4-chlorophenyl)-N-[3-(methanesulfonamido)phenyl]quinoline-4-carboxamide (PubChem CID 39204456) has the molecular formula C23H18ClN3O3S and a molecular weight of 451.94 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[3-(methanesulfonamido)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[3-(methanesulfonamido)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 39204456 |
| Molecular Formula | C23H18ClN3O3S |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[3-(methanesulfonamido)phenyl]quinoline-4-carboxamide |
| SMILES | CS(=O)(=O)Nc1cccc(NC(=O)c2cc(-c3ccc(Cl)cc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C23H18ClN3O3S/c1-31(29,30)27-18-6-4-5-17(13-18)25-23(28)20-14-22(15-9-11-16(24)12-10-15)26-21-8-3-2-7-19(20)21/h2-14,27H,1H3,(H,25,28) |
| InChIKey | MJZSZDFESWTCNA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |