C24H20ClN3O — CID 4052341
2-(4-chlorophenyl)-N-[4-(dimethylamino)phenyl]quinoline-4-carboxamide (PubChem CID 4052341) has the molecular formula C24H20ClN3O and a molecular weight of 401.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[4-(dimethylamino)phenyl]quinoline-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[4-(dimethylamino)phenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4052341 |
| Molecular Formula | C24H20ClN3O |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[4-(dimethylamino)phenyl]quinoline-4-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cc(-c3ccc(Cl)cc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H20ClN3O/c1-28(2)19-13-11-18(12-14-19)26-24(29)21-15-23(16-7-9-17(25)10-8-16)27-22-6-4-3-5-20(21)22/h3-15H,1-2H3,(H,26,29) |
| InChIKey | MMICZIVUCZSOOR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|