C22H13Cl3N2O — CID 3131012
N-(2-chlorophenyl)-2-(2,4-dichlorophenyl)quinoline-4-carboxamide (PubChem CID 3131012) has the molecular formula C22H13Cl3N2O and a molecular weight of 427.72 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(2,4-dichlorophenyl)quinoline-4-carboxamide.
| Compound Name | N-(2-chlorophenyl)-2-(2,4-dichlorophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3131012 |
| Molecular Formula | C22H13Cl3N2O |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | N-(2-chlorophenyl)-2-(2,4-dichlorophenyl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1cc(-c2ccc(Cl)cc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C22H13Cl3N2O/c23-13-9-10-15(18(25)11-13)21-12-16(14-5-1-3-7-19(14)26-21)22(28)27-20-8-4-2-6-17(20)24/h1-12H,(H,27,28) |
| InChIKey | CDRYBMQLSDZUPY-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |