C21H13Cl2N3O — CID 3601091
2-(2,4-dichlorophenyl)-N-pyridin-4-ylquinoline-4-carboxamide (PubChem CID 3601091) has the molecular formula C21H13Cl2N3O and a molecular weight of 394.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-pyridin-4-ylquinoline-4-carboxamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-pyridin-4-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3601091 |
| Molecular Formula | C21H13Cl2N3O |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-pyridin-4-ylquinoline-4-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1cc(-c2ccc(Cl)cc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C21H13Cl2N3O/c22-13-5-6-16(18(23)11-13)20-12-17(15-3-1-2-4-19(15)26-20)21(27)25-14-7-9-24-10-8-14/h1-12H,(H,24,25,27) |
| InChIKey | WLDAYHTXUXILNO-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |