C26H24Cl2N2O — CID 3309301
N-(1-adamantyl)-2-(2,4-dichlorophenyl)quinoline-4-carboxamide (PubChem CID 3309301) has the molecular formula C26H24Cl2N2O and a molecular weight of 451.40 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(2,4-dichlorophenyl)quinoline-4-carboxamide.
| Compound Name | N-(1-adamantyl)-2-(2,4-dichlorophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3309301 |
| Molecular Formula | C26H24Cl2N2O |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | N-(1-adamantyl)-2-(2,4-dichlorophenyl)quinoline-4-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1cc(-c2ccc(Cl)cc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C26H24Cl2N2O/c27-18-5-6-20(22(28)10-18)24-11-21(19-3-1-2-4-23(19)29-24)25(31)30-26-12-15-7-16(13-26)9-17(8-15)14-26/h1-6,10-11,15-17H,7-9,12-14H2,(H,30,31) |
| InChIKey | FOKSLEMYXVSENF-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |