C17H20Cl2N2O — CID 134120732
N'-(1-adamantyl)-2,5-dichlorobenzohydrazide (PubChem CID 134120732) has the molecular formula C17H20Cl2N2O and a molecular weight of 339.27 g/mol. Its IUPAC name is N'-(1-adamantyl)-2,5-dichlorobenzohydrazide.
| Compound Name | N'-(1-adamantyl)-2,5-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 134120732 |
| Molecular Formula | C17H20Cl2N2O |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N'-(1-adamantyl)-2,5-dichlorobenzohydrazide |
| SMILES | O=C(NNC12CC3CC(CC(C3)C1)C2)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H20Cl2N2O/c18-13-1-2-15(19)14(6-13)16(22)20-21-17-7-10-3-11(8-17)5-12(4-10)9-17/h1-2,6,10-12,21H,3-5,7-9H2,(H,20,22) |
| InChIKey | BONJRIZTOJPBDL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|