C19H23Cl2NO — CID 7471208
2,5-dichloro-N-[(2-methyl-2-adamantyl)methyl]benzamide (PubChem CID 7471208) has the molecular formula C19H23Cl2NO and a molecular weight of 352.31 g/mol. Its IUPAC name is 2,5-dichloro-N-[(2-methyl-2-adamantyl)methyl]benzamide.
| Compound Name | 2,5-dichloro-N-[(2-methyl-2-adamantyl)methyl]benzamide |
|---|---|
| PubChem CID | 7471208 |
| Molecular Formula | C19H23Cl2NO |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2,5-dichloro-N-[(2-methyl-2-adamantyl)methyl]benzamide |
| SMILES | CC1(CNC(=O)c2cc(Cl)ccc2Cl)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H23Cl2NO/c1-19(13-5-11-4-12(7-13)8-14(19)6-11)10-22-18(23)16-9-15(20)2-3-17(16)21/h2-3,9,11-14H,4-8,10H2,1H3,(H,22,23) |
| InChIKey | WBBXVYMFSXKITN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |