C19H25ClN2O — CID 20670042
N-(1-adamantylmethyl)-2-chloro-5-(methylamino)benzamide (PubChem CID 20670042) has the molecular formula C19H25ClN2O and a molecular weight of 332.87 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-5-(methylamino)benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-5-(methylamino)benzamide |
|---|---|
| PubChem CID | 20670042 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.87 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-5-(methylamino)benzamide |
| SMILES | CNc1ccc(Cl)c(C(=O)NCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C19H25ClN2O/c1-21-15-2-3-17(20)16(7-15)18(23)22-11-19-8-12-4-13(9-19)6-14(5-12)10-19/h2-3,7,12-14,21H,4-6,8-11H2,1H3,(H,22,23) |
| InChIKey | CAYNAIIKEMTKCM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.87 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |