C27H41ClN4O3 — CID 131724406
tert-butyl N-[2-[2-[3-(1-adamantylmethylcarbamoyl)-4-chloroanilino]ethylamino]ethyl]carbamate (PubChem CID 131724406) has the molecular formula C27H41ClN4O3 and a molecular weight of 505.10 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[3-(1-adamantylmethylcarbamoyl)-4-chloroanilino]ethylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[3-(1-adamantylmethylcarbamoyl)-4-chloroanilino]ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 131724406 |
| Molecular Formula | C27H41ClN4O3 |
| Molecular Weight | 505.10 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | tert-butyl N-[2-[2-[3-(1-adamantylmethylcarbamoyl)-4-chloroanilino]ethylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNCCNc1ccc(Cl)c(C(=O)NCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C27H41ClN4O3/c1-26(2,3)35-25(34)31-9-7-29-6-8-30-21-4-5-23(28)22(13-21)24(33)32-17-27-14-18-10-19(15-27)12-20(11-18)16-27/h4-5,13,18-20,29-30H,6-12,14-17H2,1-3H3,(H,31,34)(H,32,33) |
| InChIKey | HPRQGPUGMPKINZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.10 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|