C25H36ClN3O — CID 20670036
N-(1-adamantylmethyl)-2-chloro-5-(2-piperidin-1-ylethylamino)benzamide (PubChem CID 20670036) has the molecular formula C25H36ClN3O and a molecular weight of 430.04 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-5-(2-piperidin-1-ylethylamino)benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-5-(2-piperidin-1-ylethylamino)benzamide |
|---|---|
| PubChem CID | 20670036 |
| Molecular Formula | C25H36ClN3O |
| Molecular Weight | 430.04 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-5-(2-piperidin-1-ylethylamino)benzamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1cc(NCCN2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C25H36ClN3O/c26-23-5-4-21(27-6-9-29-7-2-1-3-8-29)13-22(23)24(30)28-17-25-14-18-10-19(15-25)12-20(11-18)16-25/h4-5,13,18-20,27H,1-3,6-12,14-17H2,(H,28,30) |
| InChIKey | VVGIUVBHYQOUIW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.04 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |