C25H37ClN2O — CID 10295424
N-(1-adamantylmethyl)-5-[3-(tert-butylamino)propyl]-2-chlorobenzamide (PubChem CID 10295424) has the molecular formula C25H37ClN2O and a molecular weight of 417.04 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-5-[3-(tert-butylamino)propyl]-2-chlorobenzamide.
| Compound Name | N-(1-adamantylmethyl)-5-[3-(tert-butylamino)propyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 10295424 |
| Molecular Formula | C25H37ClN2O |
| Molecular Weight | 417.04 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | N-(1-adamantylmethyl)-5-[3-(tert-butylamino)propyl]-2-chlorobenzamide |
| SMILES | CC(C)(C)NCCCc1ccc(Cl)c(C(=O)NCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C25H37ClN2O/c1-24(2,3)28-8-4-5-17-6-7-22(26)21(12-17)23(29)27-16-25-13-18-9-19(14-25)11-20(10-18)15-25/h6-7,12,18-20,28H,4-5,8-11,13-16H2,1-3H3,(H,27,29) |
| InChIKey | OIPLMMJERWXITG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.04 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|