C24H33ClN2O — CID 10222654
N-(1-adamantylmethyl)-2-chloro-5-[3-(prop-2-enylamino)propyl]benzamide (PubChem CID 10222654) has the molecular formula C24H33ClN2O and a molecular weight of 400.99 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-5-[3-(prop-2-enylamino)propyl]benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-5-[3-(prop-2-enylamino)propyl]benzamide |
|---|---|
| PubChem CID | 10222654 |
| Molecular Formula | C24H33ClN2O |
| Molecular Weight | 400.99 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-5-[3-(prop-2-enylamino)propyl]benzamide |
| SMILES | C=CCNCCCc1ccc(Cl)c(C(=O)NCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C24H33ClN2O/c1-2-7-26-8-3-4-17-5-6-22(25)21(12-17)23(28)27-16-24-13-18-9-19(14-24)11-20(10-18)15-24/h2,5-6,12,18-20,26H,1,3-4,7-11,13-16H2,(H,27,28) |
| InChIKey | AMFJDQIZOOYADX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.99 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|