C22H30ClNO3 — CID 69483573
N-(1-adamantylmethyl)-2-chloro-5-[(3S)-3,4-dihydroxybutyl]benzamide (PubChem CID 69483573) has the molecular formula C22H30ClNO3 and a molecular weight of 391.94 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-5-[(3S)-3,4-dihydroxybutyl]benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-5-[(3S)-3,4-dihydroxybutyl]benzamide |
|---|---|
| PubChem CID | 69483573 |
| Molecular Formula | C22H30ClNO3 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-5-[(3S)-3,4-dihydroxybutyl]benzamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1cc(CC[C@H](O)CO)ccc1Cl |
| InChI | InChI=1S/C22H30ClNO3/c23-20-4-2-14(1-3-18(26)12-25)8-19(20)21(27)24-13-22-9-15-5-16(10-22)7-17(6-15)11-22/h2,4,8,15-18,25-26H,1,3,5-7,9-13H2,(H,24,27)/t15?,16?,17?,18-,22?/m0/s1 |
| InChIKey | XYAOZYJOSDGXBE-XDHFQJGLSA-N |
| XLogP | 3.57 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |