C25H36ClN3O2 — CID 18381512
N-(1-adamantylmethyl)-2-chloro-5-[2-[2-(hydroxymethyl)piperazin-1-yl]ethyl]benzamide (PubChem CID 18381512) has the molecular formula C25H36ClN3O2 and a molecular weight of 446.04 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-chloro-5-[2-[2-(hydroxymethyl)piperazin-1-yl]ethyl]benzamide.
| Compound Name | N-(1-adamantylmethyl)-2-chloro-5-[2-[2-(hydroxymethyl)piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 18381512 |
| Molecular Formula | C25H36ClN3O2 |
| Molecular Weight | 446.04 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-(1-adamantylmethyl)-2-chloro-5-[2-[2-(hydroxymethyl)piperazin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCC12CC3CC(CC(C3)C1)C2)c1cc(CCN2CCNCC2CO)ccc1Cl |
| InChI | InChI=1S/C25H36ClN3O2/c26-23-2-1-17(3-5-29-6-4-27-14-21(29)15-30)10-22(23)24(31)28-16-25-11-18-7-19(12-25)9-20(8-18)13-25/h1-2,10,18-21,27,30H,3-9,11-16H2,(H,28,31) |
| InChIKey | QLQRJRDLLBEWCM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.04 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |