C22H30ClN3O — CID 25192712
N-(1-adamantyl)-2-chloro-5-(piperazin-1-ylmethyl)benzamide (PubChem CID 25192712) has the molecular formula C22H30ClN3O and a molecular weight of 387.96 g/mol. Its IUPAC name is N-(1-adamantyl)-2-chloro-5-(piperazin-1-ylmethyl)benzamide.
| Compound Name | N-(1-adamantyl)-2-chloro-5-(piperazin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 25192712 |
| Molecular Formula | C22H30ClN3O |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | N-(1-adamantyl)-2-chloro-5-(piperazin-1-ylmethyl)benzamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1cc(CN2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C22H30ClN3O/c23-20-2-1-15(14-26-5-3-24-4-6-26)10-19(20)21(27)25-22-11-16-7-17(12-22)9-18(8-16)13-22/h1-2,10,16-18,24H,3-9,11-14H2,(H,25,27) |
| InChIKey | FGAAYMUTTHGJIJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |