C23H32N2O — CID 41455586
N-(1-adamantyl)-4-(piperidin-1-ylmethyl)benzamide (PubChem CID 41455586) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is N-(1-adamantyl)-4-(piperidin-1-ylmethyl)benzamide.
| Compound Name | N-(1-adamantyl)-4-(piperidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 41455586 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | N-(1-adamantyl)-4-(piperidin-1-ylmethyl)benzamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C23H32N2O/c26-22(24-23-13-18-10-19(14-23)12-20(11-18)15-23)21-6-4-17(5-7-21)16-25-8-2-1-3-9-25/h4-7,18-20H,1-3,8-16H2,(H,24,26) |
| InChIKey | YQSZSBJRUZQCDA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |