C23H31ClN2O — CID 45019105
N-(1-adamantyl)-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 45019105) has the molecular formula C23H31ClN2O and a molecular weight of 386.97 g/mol. Its IUPAC name is N-(1-adamantyl)-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(1-adamantyl)-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45019105 |
| Molecular Formula | C23H31ClN2O |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-(1-adamantyl)-1-[(4-chlorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)C1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H31ClN2O/c24-21-3-1-16(2-4-21)15-26-7-5-20(6-8-26)22(27)25-23-12-17-9-18(13-23)11-19(10-17)14-23/h1-4,17-20H,5-15H2,(H,25,27) |
| InChIKey | NHDARUAJECLAQO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |