C22H28Cl2N2O3S — CID 26909871
N-(1-adamantyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 26909871) has the molecular formula C22H28Cl2N2O3S and a molecular weight of 471.45 g/mol. Its IUPAC name is N-(1-adamantyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(1-adamantyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26909871 |
| Molecular Formula | C22H28Cl2N2O3S |
| Molecular Weight | 471.45 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | N-(1-adamantyl)-1-(2,6-dichlorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)C1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C22H28Cl2N2O3S/c23-18-2-1-3-19(24)20(18)30(28,29)26-6-4-17(5-7-26)21(27)25-22-11-14-8-15(12-22)10-16(9-14)13-22/h1-3,14-17H,4-13H2,(H,25,27) |
| InChIKey | JMUYTYIJFFIKGO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |