C14H18Cl2N2O3S — CID 40630200
1-(2,6-dichlorophenyl)sulfonyl-N-ethylpiperidine-4-carboxamide (PubChem CID 40630200) has the molecular formula C14H18Cl2N2O3S and a molecular weight of 365.28 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfonyl-N-ethylpiperidine-4-carboxamide.
| Compound Name | 1-(2,6-dichlorophenyl)sulfonyl-N-ethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 40630200 |
| Molecular Formula | C14H18Cl2N2O3S |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfonyl-N-ethylpiperidine-4-carboxamide |
| SMILES | CCNC(=O)C1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C14H18Cl2N2O3S/c1-2-17-14(19)10-6-8-18(9-7-10)22(20,21)13-11(15)4-3-5-12(13)16/h3-5,10H,2,6-9H2,1H3,(H,17,19) |
| InChIKey | KHYBUNSUHBURHJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |