C13H18ClN3O3S — CID 61045541
1-[(2-chloro-4-pyridinyl)sulfonyl]-N-ethylpiperidine-4-carboxamide (PubChem CID 61045541) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is 1-[(2-chloro-4-pyridinyl)sulfonyl]-N-ethylpiperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-4-pyridinyl)sulfonyl]-N-ethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 61045541 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 1-[(2-chloro-4-pyridinyl)sulfonyl]-N-ethylpiperidine-4-carboxamide |
| SMILES | CCNC(=O)C1CCN(S(=O)(=O)c2ccnc(Cl)c2)CC1 |
| InChI | InChI=1S/C13H18ClN3O3S/c1-2-15-13(18)10-4-7-17(8-5-10)21(19,20)11-3-6-16-12(14)9-11/h3,6,9-10H,2,4-5,7-8H2,1H3,(H,15,18) |
| InChIKey | MTXZHJRPCNHSDZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|