C9H13ClN4O4S2 — CID 61045619
4-[(2-chloro-4-pyridinyl)sulfonyl]piperazine-1-sulfonamide (PubChem CID 61045619) has the molecular formula C9H13ClN4O4S2 and a molecular weight of 340.81 g/mol. Its IUPAC name is 4-[(2-chloro-4-pyridinyl)sulfonyl]piperazine-1-sulfonamide.
| Compound Name | 4-[(2-chloro-4-pyridinyl)sulfonyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61045619 |
| Molecular Formula | C9H13ClN4O4S2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 4-[(2-chloro-4-pyridinyl)sulfonyl]piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(S(=O)(=O)c2ccnc(Cl)c2)CC1 |
| InChI | InChI=1S/C9H13ClN4O4S2/c10-9-7-8(1-2-12-9)19(15,16)13-3-5-14(6-4-13)20(11,17)18/h1-2,7H,3-6H2,(H2,11,17,18) |
| InChIKey | CZPQYTPWGWALRC-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|