C13H18ClN3O2S — CID 79170156
3-[(2-chloro-4-pyridinyl)sulfonyl]-9-methyl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 79170156) has the molecular formula C13H18ClN3O2S and a molecular weight of 315.83 g/mol. Its IUPAC name is 3-[(2-chloro-4-pyridinyl)sulfonyl]-9-methyl-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-[(2-chloro-4-pyridinyl)sulfonyl]-9-methyl-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 79170156 |
| Molecular Formula | C13H18ClN3O2S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-[(2-chloro-4-pyridinyl)sulfonyl]-9-methyl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | CN1C2CCC1CN(S(=O)(=O)c1ccnc(Cl)c1)CC2 |
| InChI | InChI=1S/C13H18ClN3O2S/c1-16-10-2-3-11(16)9-17(7-5-10)20(18,19)12-4-6-15-13(14)8-12/h4,6,8,10-11H,2-3,5,7,9H2,1H3 |
| InChIKey | UWAJHUGDWBUGKR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|