C11H15ClN2O2S — CID 79183789
2-chloro-4-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyridine (PubChem CID 79183789) has the molecular formula C11H15ClN2O2S and a molecular weight of 274.77 g/mol. Its IUPAC name is 2-chloro-4-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyridine.
| Compound Name | 2-chloro-4-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyridine |
|---|---|
| PubChem CID | 79183789 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-chloro-4-(3,4-dimethylpyrrolidin-1-yl)sulfonylpyridine |
| SMILES | CC1CN(S(=O)(=O)c2ccnc(Cl)c2)CC1C |
| InChI | InChI=1S/C11H15ClN2O2S/c1-8-6-14(7-9(8)2)17(15,16)10-3-4-13-11(12)5-10/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | XPSIRCINJDKHDK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|