C11H11ClN4O2S — CID 55149786
7-[(2-chloro-4-pyridinyl)sulfonyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (PubChem CID 55149786) has the molecular formula C11H11ClN4O2S and a molecular weight of 298.75 g/mol. Its IUPAC name is 7-[(2-chloro-4-pyridinyl)sulfonyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
| Compound Name | 7-[(2-chloro-4-pyridinyl)sulfonyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 55149786 |
| Molecular Formula | C11H11ClN4O2S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 7-[(2-chloro-4-pyridinyl)sulfonyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| SMILES | O=S(=O)(c1ccnc(Cl)c1)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C11H11ClN4O2S/c12-10-7-9(1-2-13-10)19(17,18)16-6-5-15-4-3-14-11(15)8-16/h1-4,7H,5-6,8H2 |
| InChIKey | HAQHLKKQLZFIIY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|