C11H14N6O2S — CID 63024668
[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)-2-pyridinyl]hydrazine (PubChem CID 63024668) has the molecular formula C11H14N6O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)-2-pyridinyl]hydrazine.
| Compound Name | [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 63024668 |
| Molecular Formula | C11H14N6O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | [4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1cc(S(=O)(=O)N2CCn3ccnc3C2)ccn1 |
| InChI | InChI=1S/C11H14N6O2S/c12-15-10-7-9(1-2-13-10)20(18,19)17-6-5-16-4-3-14-11(16)8-17/h1-4,7H,5-6,8,12H2,(H,13,15) |
| InChIKey | VJFOWRINIGBVMA-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|