C13H16N4O3S — CID 63014254
5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)-2-methoxyaniline (PubChem CID 63014254) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)-2-methoxyaniline.
| Compound Name | 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)-2-methoxyaniline |
|---|---|
| PubChem CID | 63014254 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 5-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)-2-methoxyaniline |
| SMILES | COc1ccc(S(=O)(=O)N2CCn3ccnc3C2)cc1N |
| InChI | InChI=1S/C13H16N4O3S/c1-20-12-3-2-10(8-11(12)14)21(18,19)17-7-6-16-5-4-15-13(16)9-17/h2-5,8H,6-7,9,14H2,1H3 |
| InChIKey | HWGJFKPGMGLPRJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|