C12H13FN4O2S — CID 63322328
3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)-5-fluoroaniline (PubChem CID 63322328) has the molecular formula C12H13FN4O2S and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)-5-fluoroaniline.
| Compound Name | 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)-5-fluoroaniline |
|---|---|
| PubChem CID | 63322328 |
| Molecular Formula | C12H13FN4O2S |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)-5-fluoroaniline |
| SMILES | Nc1cc(F)cc(S(=O)(=O)N2CCn3ccnc3C2)c1 |
| InChI | InChI=1S/C12H13FN4O2S/c13-9-5-10(14)7-11(6-9)20(18,19)17-4-3-16-2-1-15-12(16)8-17/h1-2,5-7H,3-4,8,14H2 |
| InChIKey | JWBPRDPCTFANOI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|