C15H21N5O2S2 — CID 3968679
1-[3-(dimethylsulfamoyl)phenyl]-3-(3-imidazol-1-ylpropyl)thiourea (PubChem CID 3968679) has the molecular formula C15H21N5O2S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-(3-imidazol-1-ylpropyl)thiourea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(3-imidazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3968679 |
| Molecular Formula | C15H21N5O2S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(3-imidazol-1-ylpropyl)thiourea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)NCCCn2ccnc2)c1 |
| InChI | InChI=1S/C15H21N5O2S2/c1-19(2)24(21,22)14-6-3-5-13(11-14)18-15(23)17-7-4-9-20-10-8-16-12-20/h3,5-6,8,10-12H,4,7,9H2,1-2H3,(H2,17,18,23) |
| InChIKey | HMQMPFZTVSMEBN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|