C12H13BrN4O2S — CID 63014797
4-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)aniline (PubChem CID 63014797) has the molecular formula C12H13BrN4O2S and a molecular weight of 357.23 g/mol. Its IUPAC name is 4-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)aniline.
| Compound Name | 4-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)aniline |
|---|---|
| PubChem CID | 63014797 |
| Molecular Formula | C12H13BrN4O2S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 4-bromo-2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylsulfonyl)aniline |
| SMILES | Nc1ccc(Br)cc1S(=O)(=O)N1CCn2ccnc2C1 |
| InChI | InChI=1S/C12H13BrN4O2S/c13-9-1-2-10(14)11(7-9)20(18,19)17-6-5-16-4-3-15-12(16)8-17/h1-4,7H,5-6,8,14H2 |
| InChIKey | OMDBRAMCUSGWJV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|