C9H11ClN2O3S — CID 107877670
(3R)-1-[(2-chloro-4-pyridinyl)sulfonyl]pyrrolidin-3-ol (PubChem CID 107877670) has the molecular formula C9H11ClN2O3S and a molecular weight of 262.72 g/mol. Its IUPAC name is (3R)-1-[(2-chloro-4-pyridinyl)sulfonyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[(2-chloro-4-pyridinyl)sulfonyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 107877670 |
| Molecular Formula | C9H11ClN2O3S |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (3R)-1-[(2-chloro-4-pyridinyl)sulfonyl]pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1ccnc(Cl)c1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C9H11ClN2O3S/c10-9-5-8(1-3-11-9)16(14,15)12-4-2-7(13)6-12/h1,3,5,7,13H,2,4,6H2/t7-/m1/s1 |
| InChIKey | VZKSIDAJJMEQOF-SSDOTTSWSA-N |
| XLogP | 0.49 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|