C14H20ClN3O2S — CID 63169095
2-chloro-4-(3-piperidin-1-ylpyrrolidin-1-yl)sulfonylpyridine (PubChem CID 63169095) has the molecular formula C14H20ClN3O2S and a molecular weight of 329.85 g/mol. Its IUPAC name is 2-chloro-4-(3-piperidin-1-ylpyrrolidin-1-yl)sulfonylpyridine.
| Compound Name | 2-chloro-4-(3-piperidin-1-ylpyrrolidin-1-yl)sulfonylpyridine |
|---|---|
| PubChem CID | 63169095 |
| Molecular Formula | C14H20ClN3O2S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-chloro-4-(3-piperidin-1-ylpyrrolidin-1-yl)sulfonylpyridine |
| SMILES | O=S(=O)(c1ccnc(Cl)c1)N1CCC(N2CCCCC2)C1 |
| InChI | InChI=1S/C14H20ClN3O2S/c15-14-10-13(4-6-16-14)21(19,20)18-9-5-12(11-18)17-7-2-1-3-8-17/h4,6,10,12H,1-3,5,7-9,11H2 |
| InChIKey | TXTAQTDIDDZBGA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|