C14H18BrFN2O2S — CID 103697553
1-(4-bromo-3-fluorophenyl)sulfonyl-3-pyrrolidin-1-ylpyrrolidine (PubChem CID 103697553) has the molecular formula C14H18BrFN2O2S and a molecular weight of 377.28 g/mol. Its IUPAC name is 1-(4-bromo-3-fluorophenyl)sulfonyl-3-pyrrolidin-1-ylpyrrolidine.
| Compound Name | 1-(4-bromo-3-fluorophenyl)sulfonyl-3-pyrrolidin-1-ylpyrrolidine |
|---|---|
| PubChem CID | 103697553 |
| Molecular Formula | C14H18BrFN2O2S |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 1-(4-bromo-3-fluorophenyl)sulfonyl-3-pyrrolidin-1-ylpyrrolidine |
| SMILES | O=S(=O)(c1ccc(Br)c(F)c1)N1CCC(N2CCCC2)C1 |
| InChI | InChI=1S/C14H18BrFN2O2S/c15-13-4-3-12(9-14(13)16)21(19,20)18-8-5-11(10-18)17-6-1-2-7-17/h3-4,9,11H,1-2,5-8,10H2 |
| InChIKey | LFSQTTYBZPXDPL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |