C12H13BrFNO3S — CID 107652875
1-(4-bromo-3-fluorophenyl)sulfonylpiperidine-3-carbaldehyde (PubChem CID 107652875) has the molecular formula C12H13BrFNO3S and a molecular weight of 350.21 g/mol. Its IUPAC name is 1-(4-bromo-3-fluorophenyl)sulfonylpiperidine-3-carbaldehyde.
| Compound Name | 1-(4-bromo-3-fluorophenyl)sulfonylpiperidine-3-carbaldehyde |
|---|---|
| PubChem CID | 107652875 |
| Molecular Formula | C12H13BrFNO3S |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 1-(4-bromo-3-fluorophenyl)sulfonylpiperidine-3-carbaldehyde |
| SMILES | O=CC1CCCN(S(=O)(=O)c2ccc(Br)c(F)c2)C1 |
| InChI | InChI=1S/C12H13BrFNO3S/c13-11-4-3-10(6-12(11)14)19(17,18)15-5-1-2-9(7-15)8-16/h3-4,6,8-9H,1-2,5,7H2 |
| InChIKey | DDCVYJYPZARCRR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|