C13H21N5O2S — CID 79165397
[4-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)sulfonyl]-2-pyridinyl]hydrazine (PubChem CID 79165397) has the molecular formula C13H21N5O2S and a molecular weight of 311.41 g/mol. Its IUPAC name is [4-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)sulfonyl]-2-pyridinyl]hydrazine.
| Compound Name | [4-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)sulfonyl]-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 79165397 |
| Molecular Formula | C13H21N5O2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | [4-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)sulfonyl]-2-pyridinyl]hydrazine |
| SMILES | CN1C2CCC1CN(S(=O)(=O)c1ccnc(NN)c1)CC2 |
| InChI | InChI=1S/C13H21N5O2S/c1-17-10-2-3-11(17)9-18(7-5-10)21(19,20)12-4-6-15-13(8-12)16-14/h4,6,8,10-11H,2-3,5,7,9,14H2,1H3,(H,15,16) |
| InChIKey | WYYICTSTFMKNLE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|